C7F14 — CID 12789863
1,1,3,4,4,5,5,5-octafluoro-2,3-bis(trifluoromethyl)pent-1-ene (PubChem CID 12789863) has the molecular formula C7F14 and a molecular weight of 350.05 g/mol. Its IUPAC name is 1,1,3,4,4,5,5,5-octafluoro-2,3-bis(trifluoromethyl)pent-1-ene.
| Compound Name | 1,1,3,4,4,5,5,5-octafluoro-2,3-bis(trifluoromethyl)pent-1-ene |
|---|---|
| PubChem CID | 12789863 |
| Molecular Formula | C7F14 |
| Molecular Weight | 350.05 g/mol |
| Exact Mass | 349.98 |
| IUPAC Name | 1,1,3,4,4,5,5,5-octafluoro-2,3-bis(trifluoromethyl)pent-1-ene |
| SMILES | FC(F)=C(C(F)(F)F)C(F)(C(F)(F)F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7F14/c8-2(9)1(4(11,12)13)3(10,6(16,17)18)5(14,15)7(19,20)21 |
| InChIKey | KIHJTDVBGUKQIJ-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.05 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|