About 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride
8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride (PubChem CID 12790497) has the molecular formula C17H31Cl2N3O2
and a molecular weight of 380.36 g/mol. Its IUPAC name is 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride.
Molecular Properties
| Compound Name | 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride |
| PubChem CID | 12790497 |
| Molecular Formula | C17H31Cl2N3O2 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride |
| SMILES | Cl.Cl.O=C1CC2(CCCC2)CC(=O)N1CCCCN1CCNCC1 |
| InChI | InChI=1S/C17H29N3O2.2ClH/c21-15-13-17(5-1-2-6-17)14-16(22)20(15)10-4-3-9-19-11-7-18-8-12-19;;/h18H,1-14H2;2*1H |
| InChIKey | NLSREDCEOBEAIK-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride?
The IUPAC name of 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride (CID 12790497) is 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride.
What is the SMILES notation for 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride?
The canonical SMILES for 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride is Cl.Cl.O=C1CC2(CCCC2)CC(=O)N1CCCCN1CCNCC1.
What is the InChIKey of 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride?
The InChIKey is NLSREDCEOBEAIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H29N3O2.2ClH/c21-15-13-17(5-1-2-6-17)14-16(22)20(15)10-4-3-9-19-11-7-18-8-12-19;;/h18H,1-14H2;2*1H.
What are the key properties of 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride?
8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride has a molecular weight of 380.36 g/mol, XLogP of 2.22, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(4-piperazin-1-ylbutyl)-8-azaspiro[4.5]decane-7,9-dione;dihydrochloride is sourced from PubChem (CID 12790497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).