C14H15NO2 — CID 12790938
spiro[2,3-dihydro-1H-naphthalene-4,3'-piperidine]-2',6'-dione (PubChem CID 12790938) has the molecular formula C14H15NO2 and a molecular weight of 229.28 g/mol. Its IUPAC name is spiro[2,3-dihydro-1H-naphthalene-4,3'-piperidine]-2',6'-dione.
| Compound Name | spiro[2,3-dihydro-1H-naphthalene-4,3'-piperidine]-2',6'-dione |
|---|---|
| PubChem CID | 12790938 |
| Molecular Formula | C14H15NO2 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.11 |
| IUPAC Name | spiro[2,3-dihydro-1H-naphthalene-4,3'-piperidine]-2',6'-dione |
| SMILES | O=C1CCC2(CCCc3ccccc32)C(=O)N1 |
| InChI | InChI=1S/C14H15NO2/c16-12-7-9-14(13(17)15-12)8-3-5-10-4-1-2-6-11(10)14/h1-2,4,6H,3,5,7-9H2,(H,15,16,17) |
| InChIKey | GBWHKJMTBAATQB-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|