C27H30NO10PS — CID 12791059
ethyl 2-[benzylsulfonylcarbonyl-[bis(4-methoxyphenoxy)phosphorylmethyl]amino]acetate (PubChem CID 12791059) has the molecular formula C27H30NO10PS and a molecular weight of 591.58 g/mol. Its IUPAC name is ethyl 2-[benzylsulfonylcarbonyl-[bis(4-methoxyphenoxy)phosphorylmethyl]amino]acetate.
| Compound Name | ethyl 2-[benzylsulfonylcarbonyl-[bis(4-methoxyphenoxy)phosphorylmethyl]amino]acetate |
|---|---|
| PubChem CID | 12791059 |
| Molecular Formula | C27H30NO10PS |
| Molecular Weight | 591.58 g/mol |
| Exact Mass | 591.13 |
| IUPAC Name | ethyl 2-[benzylsulfonylcarbonyl-[bis(4-methoxyphenoxy)phosphorylmethyl]amino]acetate |
| SMILES | CCOC(=O)CN(CP(=O)(Oc1ccc(OC)cc1)Oc1ccc(OC)cc1)C(=O)S(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C27H30NO10PS/c1-4-36-26(29)18-28(27(30)40(32,33)19-21-8-6-5-7-9-21)20-39(31,37-24-14-10-22(34-2)11-15-24)38-25-16-12-23(35-3)13-17-25/h5-17H,4,18-20H2,1-3H3 |
| InChIKey | UTWAULMYTWDCPX-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 134.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.58 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|