About 5-but-3-enyl-3,3-diphenyloxolan-2-one
5-but-3-enyl-3,3-diphenyloxolan-2-one (PubChem CID 12791584) has the molecular formula C20H20O2
and a molecular weight of 292.38 g/mol. Its IUPAC name is 5-but-3-enyl-3,3-diphenyloxolan-2-one.
Molecular Properties
| Compound Name | 5-but-3-enyl-3,3-diphenyloxolan-2-one |
| PubChem CID | 12791584 |
| Molecular Formula | C20H20O2 |
| Molecular Weight | 292.38 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 5-but-3-enyl-3,3-diphenyloxolan-2-one |
| SMILES | C=CCCC1CC(c2ccccc2)(c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C20H20O2/c1-2-3-14-18-15-20(19(21)22-18,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h2,4-13,18H,1,3,14-15H2 |
| InChIKey | PWWANJMBTQRPIQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.38 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-but-3-enyl-3,3-diphenyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-but-3-enyl-3,3-diphenyloxolan-2-one?
The IUPAC name of 5-but-3-enyl-3,3-diphenyloxolan-2-one (CID 12791584) is 5-but-3-enyl-3,3-diphenyloxolan-2-one.
What is the SMILES notation for 5-but-3-enyl-3,3-diphenyloxolan-2-one?
The canonical SMILES for 5-but-3-enyl-3,3-diphenyloxolan-2-one is C=CCCC1CC(c2ccccc2)(c2ccccc2)C(=O)O1.
What is the InChIKey of 5-but-3-enyl-3,3-diphenyloxolan-2-one?
The InChIKey is PWWANJMBTQRPIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20O2/c1-2-3-14-18-15-20(19(21)22-18,16-10-6-4-7-11-16)17-12-8-5-9-13-17/h2,4-13,18H,1,3,14-15H2.
What are the key properties of 5-but-3-enyl-3,3-diphenyloxolan-2-one?
5-but-3-enyl-3,3-diphenyloxolan-2-one has a molecular weight of 292.38 g/mol, XLogP of 4.25, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-but-3-enyl-3,3-diphenyloxolan-2-one is sourced from PubChem (CID 12791584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).