About hepta-1,6-dien-4-amine
hepta-1,6-dien-4-amine (PubChem CID 12791689) has the molecular formula C7H13N
and a molecular weight of 111.19 g/mol. Its IUPAC name is hepta-1,6-dien-4-amine.
Molecular Properties
| Compound Name | hepta-1,6-dien-4-amine |
| PubChem CID | 12791689 |
| Molecular Formula | C7H13N |
| Molecular Weight | 111.19 g/mol |
| Exact Mass | 111.10 |
| IUPAC Name | hepta-1,6-dien-4-amine |
| SMILES | C=CCC(N)CC=C |
| InChI | InChI=1S/C7H13N/c1-3-5-7(8)6-4-2/h3-4,7H,1-2,5-6,8H2 |
| InChIKey | NQOGMRGPEFZPDM-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.19 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze hepta-1,6-dien-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hepta-1,6-dien-4-amine?
The IUPAC name of hepta-1,6-dien-4-amine (CID 12791689) is hepta-1,6-dien-4-amine.
What is the SMILES notation for hepta-1,6-dien-4-amine?
The canonical SMILES for hepta-1,6-dien-4-amine is C=CCC(N)CC=C.
What is the InChIKey of hepta-1,6-dien-4-amine?
The InChIKey is NQOGMRGPEFZPDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13N/c1-3-5-7(8)6-4-2/h3-4,7H,1-2,5-6,8H2.
What are the key properties of hepta-1,6-dien-4-amine?
hepta-1,6-dien-4-amine has a molecular weight of 111.19 g/mol, XLogP of 1.47, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hepta-1,6-dien-4-amine is sourced from PubChem (CID 12791689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).