About 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan
2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan (PubChem CID 12791814) has the molecular formula C8H12O
and a molecular weight of 124.18 g/mol. Its IUPAC name is 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan.
Analyze 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan?
The IUPAC name of 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan (CID 12791814) is 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan.
What is the SMILES notation for 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan?
The canonical SMILES for 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan is C=C1CC2CCCC2O1.
What is the InChIKey of 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan?
The InChIKey is IRTUAQQHNCOIHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O/c1-6-5-7-3-2-4-8(7)9-6/h7-8H,1-5H2.
What are the key properties of 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan?
2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan has a molecular weight of 124.18 g/mol, XLogP of 2.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylidene-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan is sourced from PubChem (CID 12791814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).