About 3-amino-6-chloro-1,3-benzoxazine-2,4-dione
3-amino-6-chloro-1,3-benzoxazine-2,4-dione (PubChem CID 12792175) has the molecular formula C8H5ClN2O3
and a molecular weight of 212.59 g/mol. Its IUPAC name is 3-amino-6-chloro-1,3-benzoxazine-2,4-dione.
Molecular Properties
| Compound Name | 3-amino-6-chloro-1,3-benzoxazine-2,4-dione |
| PubChem CID | 12792175 |
| Molecular Formula | C8H5ClN2O3 |
| Molecular Weight | 212.59 g/mol |
| Exact Mass | 212.00 |
| IUPAC Name | 3-amino-6-chloro-1,3-benzoxazine-2,4-dione |
| SMILES | Nn1c(=O)oc2ccc(Cl)cc2c1=O |
| InChI | InChI=1S/C8H5ClN2O3/c9-4-1-2-6-5(3-4)7(12)11(10)8(13)14-6/h1-3H,10H2 |
| InChIKey | RKXCSTHKAMUUQC-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 78.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.59 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-amino-6-chloro-1,3-benzoxazine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-6-chloro-1,3-benzoxazine-2,4-dione?
The IUPAC name of 3-amino-6-chloro-1,3-benzoxazine-2,4-dione (CID 12792175) is 3-amino-6-chloro-1,3-benzoxazine-2,4-dione.
What is the SMILES notation for 3-amino-6-chloro-1,3-benzoxazine-2,4-dione?
The canonical SMILES for 3-amino-6-chloro-1,3-benzoxazine-2,4-dione is Nn1c(=O)oc2ccc(Cl)cc2c1=O.
What is the InChIKey of 3-amino-6-chloro-1,3-benzoxazine-2,4-dione?
The InChIKey is RKXCSTHKAMUUQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClN2O3/c9-4-1-2-6-5(3-4)7(12)11(10)8(13)14-6/h1-3H,10H2.
What are the key properties of 3-amino-6-chloro-1,3-benzoxazine-2,4-dione?
3-amino-6-chloro-1,3-benzoxazine-2,4-dione has a molecular weight of 212.59 g/mol, XLogP of 0.32, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-6-chloro-1,3-benzoxazine-2,4-dione is sourced from PubChem (CID 12792175), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).