About 4-bromo-2-ethylthiophene
4-bromo-2-ethylthiophene (PubChem CID 12792388) has the molecular formula C6H7BrS
and a molecular weight of 191.09 g/mol. Its IUPAC name is 4-bromo-2-ethylthiophene.
Molecular Properties
| Compound Name | 4-bromo-2-ethylthiophene |
| PubChem CID | 12792388 |
| Molecular Formula | C6H7BrS |
| Molecular Weight | 191.09 g/mol |
| Exact Mass | 189.95 |
| IUPAC Name | 4-bromo-2-ethylthiophene |
| SMILES | CCc1cc(Br)cs1 |
| InChI | InChI=1S/C6H7BrS/c1-2-6-3-5(7)4-8-6/h3-4H,2H2,1H3 |
| InChIKey | WQAHNJBJOOVOIQ-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.09 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-bromo-2-ethylthiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-ethylthiophene?
The IUPAC name of 4-bromo-2-ethylthiophene (CID 12792388) is 4-bromo-2-ethylthiophene.
What is the SMILES notation for 4-bromo-2-ethylthiophene?
The canonical SMILES for 4-bromo-2-ethylthiophene is CCc1cc(Br)cs1.
What is the InChIKey of 4-bromo-2-ethylthiophene?
The InChIKey is WQAHNJBJOOVOIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7BrS/c1-2-6-3-5(7)4-8-6/h3-4H,2H2,1H3.
What are the key properties of 4-bromo-2-ethylthiophene?
4-bromo-2-ethylthiophene has a molecular weight of 191.09 g/mol, XLogP of 3.07, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-ethylthiophene is sourced from PubChem (CID 12792388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).