About methyl 5-(methylamino)-1,3-thiazole-4-carboxylate
methyl 5-(methylamino)-1,3-thiazole-4-carboxylate (PubChem CID 12792584) has the molecular formula C6H8N2O2S
and a molecular weight of 172.21 g/mol. Its IUPAC name is methyl 5-(methylamino)-1,3-thiazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 5-(methylamino)-1,3-thiazole-4-carboxylate |
| PubChem CID | 12792584 |
| Molecular Formula | C6H8N2O2S |
| Molecular Weight | 172.21 g/mol |
| Exact Mass | 172.03 |
| IUPAC Name | methyl 5-(methylamino)-1,3-thiazole-4-carboxylate |
| SMILES | CNc1scnc1C(=O)OC |
| InChI | InChI=1S/C6H8N2O2S/c1-7-5-4(6(9)10-2)8-3-11-5/h3,7H,1-2H3 |
| InChIKey | INQFUFJEKDAJER-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze methyl 5-(methylamino)-1,3-thiazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 5-(methylamino)-1,3-thiazole-4-carboxylate?
The IUPAC name of methyl 5-(methylamino)-1,3-thiazole-4-carboxylate (CID 12792584) is methyl 5-(methylamino)-1,3-thiazole-4-carboxylate.
What is the SMILES notation for methyl 5-(methylamino)-1,3-thiazole-4-carboxylate?
The canonical SMILES for methyl 5-(methylamino)-1,3-thiazole-4-carboxylate is CNc1scnc1C(=O)OC.
What is the InChIKey of methyl 5-(methylamino)-1,3-thiazole-4-carboxylate?
The InChIKey is INQFUFJEKDAJER-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2S/c1-7-5-4(6(9)10-2)8-3-11-5/h3,7H,1-2H3.
What are the key properties of methyl 5-(methylamino)-1,3-thiazole-4-carboxylate?
methyl 5-(methylamino)-1,3-thiazole-4-carboxylate has a molecular weight of 172.21 g/mol, XLogP of 0.97, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 5-(methylamino)-1,3-thiazole-4-carboxylate is sourced from PubChem (CID 12792584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).