C18H17ClF2N6O — CID 1279298
4-N-benzyl-2-N-[4-[chloro(difluoro)methoxy]phenyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 1279298) has the molecular formula C18H17ClF2N6O and a molecular weight of 406.82 g/mol. Its IUPAC name is 4-N-benzyl-2-N-[4-[chloro(difluoro)methoxy]phenyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-benzyl-2-N-[4-[chloro(difluoro)methoxy]phenyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 1279298 |
| Molecular Formula | C18H17ClF2N6O |
| Molecular Weight | 406.82 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 4-N-benzyl-2-N-[4-[chloro(difluoro)methoxy]phenyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(NCc2ccccc2)nc(Nc2ccc(OC(F)(F)Cl)cc2)n1 |
| InChI | InChI=1S/C18H17ClF2N6O/c1-22-15-25-16(23-11-12-5-3-2-4-6-12)27-17(26-15)24-13-7-9-14(10-8-13)28-18(19,20)21/h2-10H,11H2,1H3,(H3,22,23,24,25,26,27) |
| InChIKey | QBKWLXGKMXRJMK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.82 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|