About 2,3-dimethyl-4-nitro-1,2-oxazol-5-one
2,3-dimethyl-4-nitro-1,2-oxazol-5-one (PubChem CID 12793037) has the molecular formula C5H6N2O4
and a molecular weight of 158.11 g/mol. Its IUPAC name is 2,3-dimethyl-4-nitro-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | 2,3-dimethyl-4-nitro-1,2-oxazol-5-one |
| PubChem CID | 12793037 |
| Molecular Formula | C5H6N2O4 |
| Molecular Weight | 158.11 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | 2,3-dimethyl-4-nitro-1,2-oxazol-5-one |
| SMILES | Cc1c([N+](=O)[O-])c(=O)on1C |
| InChI | InChI=1S/C5H6N2O4/c1-3-4(7(9)10)5(8)11-6(3)2/h1-2H3 |
| InChIKey | WIWFWZFOQOZETD-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 78.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.11 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dimethyl-4-nitro-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dimethyl-4-nitro-1,2-oxazol-5-one?
The IUPAC name of 2,3-dimethyl-4-nitro-1,2-oxazol-5-one (CID 12793037) is 2,3-dimethyl-4-nitro-1,2-oxazol-5-one.
What is the SMILES notation for 2,3-dimethyl-4-nitro-1,2-oxazol-5-one?
The canonical SMILES for 2,3-dimethyl-4-nitro-1,2-oxazol-5-one is Cc1c([N+](=O)[O-])c(=O)on1C.
What is the InChIKey of 2,3-dimethyl-4-nitro-1,2-oxazol-5-one?
The InChIKey is WIWFWZFOQOZETD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N2O4/c1-3-4(7(9)10)5(8)11-6(3)2/h1-2H3.
What are the key properties of 2,3-dimethyl-4-nitro-1,2-oxazol-5-one?
2,3-dimethyl-4-nitro-1,2-oxazol-5-one has a molecular weight of 158.11 g/mol, XLogP of 0.19, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dimethyl-4-nitro-1,2-oxazol-5-one is sourced from PubChem (CID 12793037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).