C15H19ClF2N6O — CID 1279309
2-N-tert-butyl-4-N-[4-[chloro(difluoro)methoxy]phenyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine (PubChem CID 1279309) has the molecular formula C15H19ClF2N6O and a molecular weight of 372.81 g/mol. Its IUPAC name is 2-N-tert-butyl-4-N-[4-[chloro(difluoro)methoxy]phenyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 2-N-tert-butyl-4-N-[4-[chloro(difluoro)methoxy]phenyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 1279309 |
| Molecular Formula | C15H19ClF2N6O |
| Molecular Weight | 372.81 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 2-N-tert-butyl-4-N-[4-[chloro(difluoro)methoxy]phenyl]-6-N-methyl-1,3,5-triazine-2,4,6-triamine |
| SMILES | CNc1nc(Nc2ccc(OC(F)(F)Cl)cc2)nc(NC(C)(C)C)n1 |
| InChI | InChI=1S/C15H19ClF2N6O/c1-14(2,3)24-13-22-11(19-4)21-12(23-13)20-9-5-7-10(8-6-9)25-15(16,17)18/h5-8H,1-4H3,(H3,19,20,21,22,23,24) |
| InChIKey | FOWNDPZJPYCWNR-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 83.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.81 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|