About (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine
(3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine (PubChem CID 12793492) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine.
Molecular Properties
| Compound Name | (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine |
| PubChem CID | 12793492 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine |
| SMILES | Cc1noc2ccc(NN)nc12 |
| InChI | InChI=1S/C7H8N4O/c1-4-7-5(12-11-4)2-3-6(9-7)10-8/h2-3H,8H2,1H3,(H,9,10) |
| InChIKey | PRTRUFNRBRJFFQ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 76.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine?
The IUPAC name of (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine (CID 12793492) is (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine.
What is the SMILES notation for (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine?
The canonical SMILES for (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine is Cc1noc2ccc(NN)nc12.
What is the InChIKey of (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine?
The InChIKey is PRTRUFNRBRJFFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-4-7-5(12-11-4)2-3-6(9-7)10-8/h2-3H,8H2,1H3,(H,9,10).
What are the key properties of (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine?
(3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine has a molecular weight of 164.17 g/mol, XLogP of 0.82, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-[1,2]oxazolo[4,5-b]pyridin-5-yl)hydrazine is sourced from PubChem (CID 12793492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).