About 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine
3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine (PubChem CID 12793559) has the molecular formula C13H17N3O
and a molecular weight of 231.30 g/mol. Its IUPAC name is 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine.
Molecular Properties
| Compound Name | 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine |
| PubChem CID | 12793559 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine |
| SMILES | Nc1ccc2c(c1)OCC(N1CCCCC1)=N2 |
| InChI | InChI=1S/C13H17N3O/c14-10-4-5-11-12(8-10)17-9-13(15-11)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7,9,14H2 |
| InChIKey | GDJKNIOLHFWULS-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine?
The IUPAC name of 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine (CID 12793559) is 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine.
What is the SMILES notation for 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine?
The canonical SMILES for 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine is Nc1ccc2c(c1)OCC(N1CCCCC1)=N2.
What is the InChIKey of 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine?
The InChIKey is GDJKNIOLHFWULS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N3O/c14-10-4-5-11-12(8-10)17-9-13(15-11)16-6-2-1-3-7-16/h4-5,8H,1-3,6-7,9,14H2.
What are the key properties of 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine?
3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine has a molecular weight of 231.30 g/mol, XLogP of 2.18, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-piperidin-1-yl-2H-1,4-benzoxazin-7-amine is sourced from PubChem (CID 12793559), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).