C10H20O2Si — CID 12793734
2,2-di(propan-2-yl)-4,7-dihydro-1,3,2-dioxasilepine (PubChem CID 12793734) has the molecular formula C10H20O2Si and a molecular weight of 200.35 g/mol. Its IUPAC name is 2,2-di(propan-2-yl)-4,7-dihydro-1,3,2-dioxasilepine.
| Compound Name | 2,2-di(propan-2-yl)-4,7-dihydro-1,3,2-dioxasilepine |
|---|---|
| PubChem CID | 12793734 |
| Molecular Formula | C10H20O2Si |
| Molecular Weight | 200.35 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 2,2-di(propan-2-yl)-4,7-dihydro-1,3,2-dioxasilepine |
| SMILES | CC(C)[Si]1(C(C)C)OCC=CCO1 |
| InChI | InChI=1S/C10H20O2Si/c1-9(2)13(10(3)4)11-7-5-6-8-12-13/h5-6,9-10H,7-8H2,1-4H3 |
| InChIKey | JQQSYDRVWHGLSZ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.35 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|