C24H72Si12 — CID 12793745
[1,2,2,3,3,4,4-heptakis(trimethylsilyl)tetrasiletan-1-yl]-trimethylsilane (PubChem CID 12793745) has the molecular formula C24H72Si12 and a molecular weight of 697.87 g/mol. Its IUPAC name is [1,2,2,3,3,4,4-heptakis(trimethylsilyl)tetrasiletan-1-yl]-trimethylsilane.
| Compound Name | [1,2,2,3,3,4,4-heptakis(trimethylsilyl)tetrasiletan-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 12793745 |
| Molecular Formula | C24H72Si12 |
| Molecular Weight | 697.87 g/mol |
| Exact Mass | 696.29 |
| IUPAC Name | [1,2,2,3,3,4,4-heptakis(trimethylsilyl)tetrasiletan-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)[Si]1([Si](C)(C)C)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si]([Si](C)(C)C)([Si](C)(C)C)[Si]1([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C24H72Si12/c1-25(2,3)33(26(4,5)6)34(27(7,8)9,28(10,11)12)36(31(19,20)21,32(22,23)24)35(33,29(13,14)15)30(16,17)18/h1-24H3 |
| InChIKey | JPXGMXXVGJYDKK-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.87 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|