About (5S)-3,5-dimethylimidazolidin-4-one
(5S)-3,5-dimethylimidazolidin-4-one (PubChem CID 12794136) has the molecular formula C5H10N2O
and a molecular weight of 114.15 g/mol. Its IUPAC name is (5S)-3,5-dimethylimidazolidin-4-one.
Molecular Properties
| Compound Name | (5S)-3,5-dimethylimidazolidin-4-one |
| PubChem CID | 12794136 |
| Molecular Formula | C5H10N2O |
| Molecular Weight | 114.15 g/mol |
| Exact Mass | 114.08 |
| IUPAC Name | (5S)-3,5-dimethylimidazolidin-4-one |
| SMILES | C[C@@H]1NCN(C)C1=O |
| InChI | InChI=1S/C5H10N2O/c1-4-5(8)7(2)3-6-4/h4,6H,3H2,1-2H3/t4-/m0/s1 |
| InChIKey | VPZBJFGUILDYED-BYPYZUCNSA-N |
| XLogP | -0.61 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 114.15 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-3,5-dimethylimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-3,5-dimethylimidazolidin-4-one?
The IUPAC name of (5S)-3,5-dimethylimidazolidin-4-one (CID 12794136) is (5S)-3,5-dimethylimidazolidin-4-one.
What is the SMILES notation for (5S)-3,5-dimethylimidazolidin-4-one?
The canonical SMILES for (5S)-3,5-dimethylimidazolidin-4-one is C[C@@H]1NCN(C)C1=O.
What is the InChIKey of (5S)-3,5-dimethylimidazolidin-4-one?
The InChIKey is VPZBJFGUILDYED-BYPYZUCNSA-N. The full InChI is InChI=1S/C5H10N2O/c1-4-5(8)7(2)3-6-4/h4,6H,3H2,1-2H3/t4-/m0/s1.
What are the key properties of (5S)-3,5-dimethylimidazolidin-4-one?
(5S)-3,5-dimethylimidazolidin-4-one has a molecular weight of 114.15 g/mol, XLogP of -0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-3,5-dimethylimidazolidin-4-one is sourced from PubChem (CID 12794136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).