About 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene
5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene (PubChem CID 12794218) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene.
Molecular Properties
| Compound Name | 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene |
| PubChem CID | 12794218 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene |
| SMILES | CC1=NOC2C3CCC(C3)C12 |
| InChI | InChI=1S/C9H13NO/c1-5-8-6-2-3-7(4-6)9(8)11-10-5/h6-9H,2-4H2,1H3 |
| InChIKey | MOGAHUMTFBOGMZ-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene?
The IUPAC name of 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene (CID 12794218) is 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene.
What is the SMILES notation for 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene?
The canonical SMILES for 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene is CC1=NOC2C3CCC(C3)C12.
What is the InChIKey of 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene?
The InChIKey is MOGAHUMTFBOGMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-5-8-6-2-3-7(4-6)9(8)11-10-5/h6-9H,2-4H2,1H3.
What are the key properties of 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene?
5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene has a molecular weight of 151.21 g/mol, XLogP of 1.81, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene is sourced from PubChem (CID 12794218), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).