About 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane
9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane (PubChem CID 12794267) has the molecular formula C12H22S2
and a molecular weight of 230.44 g/mol. Its IUPAC name is 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane.
Molecular Properties
| Compound Name | 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane |
| PubChem CID | 12794267 |
| Molecular Formula | C12H22S2 |
| Molecular Weight | 230.44 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane |
| SMILES | CC1CCC(C(C)C)C2(C1)SCCS2 |
| InChI | InChI=1S/C12H22S2/c1-9(2)11-5-4-10(3)8-12(11)13-6-7-14-12/h9-11H,4-8H2,1-3H3 |
| InChIKey | DNXUKZZSEGMLQQ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.44 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane?
The IUPAC name of 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane (CID 12794267) is 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane.
What is the SMILES notation for 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane?
The canonical SMILES for 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane is CC1CCC(C(C)C)C2(C1)SCCS2.
What is the InChIKey of 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane?
The InChIKey is DNXUKZZSEGMLQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22S2/c1-9(2)11-5-4-10(3)8-12(11)13-6-7-14-12/h9-11H,4-8H2,1-3H3.
What are the key properties of 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane?
9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane has a molecular weight of 230.44 g/mol, XLogP of 4.25, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-6-propan-2-yl-1,4-dithiaspiro[4.5]decane is sourced from PubChem (CID 12794267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).