About 2-chloro-4,6-diethyl-1,3,5-triazine
2-chloro-4,6-diethyl-1,3,5-triazine (PubChem CID 12795) has the molecular formula C7H10ClN3
and a molecular weight of 171.63 g/mol. Its IUPAC name is 2-chloro-4,6-diethyl-1,3,5-triazine.
Molecular Properties
| Compound Name | 2-chloro-4,6-diethyl-1,3,5-triazine |
| PubChem CID | 12795 |
| Molecular Formula | C7H10ClN3 |
| Molecular Weight | 171.63 g/mol |
| Exact Mass | 171.06 |
| IUPAC Name | 2-chloro-4,6-diethyl-1,3,5-triazine |
| SMILES | CCc1nc(Cl)nc(CC)n1 |
| InChI | InChI=1S/C7H10ClN3/c1-3-5-9-6(4-2)11-7(8)10-5/h3-4H2,1-2H3 |
| InChIKey | XTLZSQZATHNMBX-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.63 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chloro-4,6-diethyl-1,3,5-triazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4,6-diethyl-1,3,5-triazine?
The IUPAC name of 2-chloro-4,6-diethyl-1,3,5-triazine (CID 12795) is 2-chloro-4,6-diethyl-1,3,5-triazine.
What is the SMILES notation for 2-chloro-4,6-diethyl-1,3,5-triazine?
The canonical SMILES for 2-chloro-4,6-diethyl-1,3,5-triazine is CCc1nc(Cl)nc(CC)n1.
What is the InChIKey of 2-chloro-4,6-diethyl-1,3,5-triazine?
The InChIKey is XTLZSQZATHNMBX-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10ClN3/c1-3-5-9-6(4-2)11-7(8)10-5/h3-4H2,1-2H3.
What are the key properties of 2-chloro-4,6-diethyl-1,3,5-triazine?
2-chloro-4,6-diethyl-1,3,5-triazine has a molecular weight of 171.63 g/mol, XLogP of 1.65, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4,6-diethyl-1,3,5-triazine is sourced from PubChem (CID 12795), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).