C10H11N3O — CID 12795384
2,4,6-trimethyl-8H-pyrido[2,3-d]pyrimidin-7-one (PubChem CID 12795384) has the molecular formula C10H11N3O and a molecular weight of 189.22 g/mol. Its IUPAC name is 2,4,6-trimethyl-8H-pyrido[2,3-d]pyrimidin-7-one.
| Compound Name | 2,4,6-trimethyl-8H-pyrido[2,3-d]pyrimidin-7-one |
|---|---|
| PubChem CID | 12795384 |
| Molecular Formula | C10H11N3O |
| Molecular Weight | 189.22 g/mol |
| Exact Mass | 189.09 |
| IUPAC Name | 2,4,6-trimethyl-8H-pyrido[2,3-d]pyrimidin-7-one |
| SMILES | Cc1nc(C)c2cc(C)c(=O)[nH]c2n1 |
| InChI | InChI=1S/C10H11N3O/c1-5-4-8-6(2)11-7(3)12-9(8)13-10(5)14/h4H,1-3H3,(H,11,12,13,14) |
| InChIKey | CQEOSSHAOCXRKT-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |