About methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate
methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 12795669) has the molecular formula C15H14N2O2
and a molecular weight of 254.29 g/mol. Its IUPAC name is methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| PubChem CID | 12795669 |
| Molecular Formula | C15H14N2O2 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | CCc1c(C(=O)OC)ncc2[nH]c3ccccc3c12 |
| InChI | InChI=1S/C15H14N2O2/c1-3-9-13-10-6-4-5-7-11(10)17-12(13)8-16-14(9)15(18)19-2/h4-8,17H,3H2,1-2H3 |
| InChIKey | KRQWXIVQQMTXMI-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate?
The IUPAC name of methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate (CID 12795669) is methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate.
What is the SMILES notation for methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate?
The canonical SMILES for methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate is CCc1c(C(=O)OC)ncc2[nH]c3ccccc3c12.
What is the InChIKey of methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate?
The InChIKey is KRQWXIVQQMTXMI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O2/c1-3-9-13-10-6-4-5-7-11(10)17-12(13)8-16-14(9)15(18)19-2/h4-8,17H,3H2,1-2H3.
What are the key properties of methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate?
methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate has a molecular weight of 254.29 g/mol, XLogP of 3.07, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-ethyl-9H-pyrido[3,4-b]indole-3-carboxylate is sourced from PubChem (CID 12795669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).