About N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide
N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide (PubChem CID 127958386) has the molecular formula C14H24N4O3S
and a molecular weight of 328.44 g/mol. Its IUPAC name is N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide.
Molecular Properties
| Compound Name | N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide |
| PubChem CID | 127958386 |
| Molecular Formula | C14H24N4O3S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.16 |
| IUPAC Name | N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide |
| SMILES | CCn1ccnc1[C@H]1OCCC[C@@H]1NS(=O)(=O)N1CCCC1 |
| InChI | InChI=1S/C14H24N4O3S/c1-2-17-10-7-15-14(17)13-12(6-5-11-21-13)16-22(19,20)18-8-3-4-9-18/h7,10,12-13,16H,2-6,8-9,11H2,1H3/t12-,13-/m0/s1 |
| InChIKey | AXVZFWTUNDFFKW-STQMWFEESA-N |
| XLogP | 1.05 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide?
The IUPAC name of N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide (CID 127958386) is N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide.
What is the SMILES notation for N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide?
The canonical SMILES for N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide is CCn1ccnc1[C@H]1OCCC[C@@H]1NS(=O)(=O)N1CCCC1.
What is the InChIKey of N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide?
The InChIKey is AXVZFWTUNDFFKW-STQMWFEESA-N. The full InChI is InChI=1S/C14H24N4O3S/c1-2-17-10-7-15-14(17)13-12(6-5-11-21-13)16-22(19,20)18-8-3-4-9-18/h7,10,12-13,16H,2-6,8-9,11H2,1H3/t12-,13-/m0/s1.
What are the key properties of N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide?
N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide has a molecular weight of 328.44 g/mol, XLogP of 1.05, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2S,3S)-2-(1-ethylimidazol-2-yl)oxan-3-yl]pyrrolidine-1-sulfonamide is sourced from PubChem (CID 127958386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).