About 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one
7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one (PubChem CID 127958529) has the molecular formula C12H17N3O3S
and a molecular weight of 283.35 g/mol. Its IUPAC name is 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one.
Molecular Properties
| Compound Name | 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one |
| PubChem CID | 127958529 |
| Molecular Formula | C12H17N3O3S |
| Molecular Weight | 283.35 g/mol |
| Exact Mass | 283.10 |
| IUPAC Name | 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one |
| SMILES | CCn1cnc2c(c1=O)CCN(S(=O)(=O)C1CC1)C2 |
| InChI | InChI=1S/C12H17N3O3S/c1-2-14-8-13-11-7-15(6-5-10(11)12(14)16)19(17,18)9-3-4-9/h8-9H,2-7H2,1H3 |
| InChIKey | MDCSBOKQEWBTRV-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.35 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one?
The IUPAC name of 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one (CID 127958529) is 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one.
What is the SMILES notation for 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one?
The canonical SMILES for 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one is CCn1cnc2c(c1=O)CCN(S(=O)(=O)C1CC1)C2.
What is the InChIKey of 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one?
The InChIKey is MDCSBOKQEWBTRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17N3O3S/c1-2-14-8-13-11-7-15(6-5-10(11)12(14)16)19(17,18)9-3-4-9/h8-9H,2-7H2,1H3.
What are the key properties of 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one?
7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one has a molecular weight of 283.35 g/mol, XLogP of 0.11, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-cyclopropylsulfonyl-3-ethyl-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-one is sourced from PubChem (CID 127958529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).