About (3-hydroxyphenyl)urea
(3-hydroxyphenyl)urea (PubChem CID 12796) has the molecular formula C7H8N2O2
and a molecular weight of 152.15 g/mol. Its IUPAC name is (3-hydroxyphenyl)urea.
Molecular Properties
| Compound Name | (3-hydroxyphenyl)urea |
| PubChem CID | 12796 |
| Molecular Formula | C7H8N2O2 |
| Molecular Weight | 152.15 g/mol |
| Exact Mass | 152.06 |
| IUPAC Name | (3-hydroxyphenyl)urea |
| SMILES | NC(=O)Nc1cccc(O)c1 |
| InChI | InChI=1S/C7H8N2O2/c8-7(11)9-5-2-1-3-6(10)4-5/h1-4,10H,(H3,8,9,11) |
| InChIKey | IPRCBIWIPMJXIK-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 152.15 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3-hydroxyphenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-hydroxyphenyl)urea?
The IUPAC name of (3-hydroxyphenyl)urea (CID 12796) is (3-hydroxyphenyl)urea.
What is the SMILES notation for (3-hydroxyphenyl)urea?
The canonical SMILES for (3-hydroxyphenyl)urea is NC(=O)Nc1cccc(O)c1.
What is the InChIKey of (3-hydroxyphenyl)urea?
The InChIKey is IPRCBIWIPMJXIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2/c8-7(11)9-5-2-1-3-6(10)4-5/h1-4,10H,(H3,8,9,11).
What are the key properties of (3-hydroxyphenyl)urea?
(3-hydroxyphenyl)urea has a molecular weight of 152.15 g/mol, XLogP of 0.88, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3-hydroxyphenyl)urea is sourced from PubChem (CID 12796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).