About N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide
N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide (PubChem CID 127960643) has the molecular formula C17H18FN3O3
and a molecular weight of 331.35 g/mol. Its IUPAC name is N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide |
| PubChem CID | 127960643 |
| Molecular Formula | C17H18FN3O3 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide |
| SMILES | O=C(NC1CCOc2c(F)cccc21)c1cn[nH]c1C1CCOC1 |
| InChI | InChI=1S/C17H18FN3O3/c18-13-3-1-2-11-14(5-7-24-16(11)13)20-17(22)12-8-19-21-15(12)10-4-6-23-9-10/h1-3,8,10,14H,4-7,9H2,(H,19,21)(H,20,22) |
| InChIKey | LIDXPZIBWJTWIP-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 76.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide?
The IUPAC name of N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide (CID 127960643) is N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide.
What is the SMILES notation for N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide?
The canonical SMILES for N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide is O=C(NC1CCOc2c(F)cccc21)c1cn[nH]c1C1CCOC1.
What is the InChIKey of N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide?
The InChIKey is LIDXPZIBWJTWIP-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18FN3O3/c18-13-3-1-2-11-14(5-7-24-16(11)13)20-17(22)12-8-19-21-15(12)10-4-6-23-9-10/h1-3,8,10,14H,4-7,9H2,(H,19,21)(H,20,22).
What are the key properties of N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide?
N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide has a molecular weight of 331.35 g/mol, XLogP of 2.31, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(8-fluoro-3,4-dihydro-2H-chromen-4-yl)-5-(oxolan-3-yl)-1H-pyrazole-4-carboxamide is sourced from PubChem (CID 127960643), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).