C8H10F2O4 — CID 12796353
(3aR,4R,5S,6aR)-6,6-difluoro-2,5-dihydroxy-2,3,3a,4,5,6a-hexahydrocyclopenta[b]furan-4-carbaldehyde (PubChem CID 12796353) has the molecular formula C8H10F2O4 and a molecular weight of 208.16 g/mol. Its IUPAC name is (3aR,4R,5S,6aR)-6,6-difluoro-2,5-dihydroxy-2,3,3a,4,5,6a-hexahydrocyclopenta[b]furan-4-carbaldehyde.
| Compound Name | (3aR,4R,5S,6aR)-6,6-difluoro-2,5-dihydroxy-2,3,3a,4,5,6a-hexahydrocyclopenta[b]furan-4-carbaldehyde |
|---|---|
| PubChem CID | 12796353 |
| Molecular Formula | C8H10F2O4 |
| Molecular Weight | 208.16 g/mol |
| Exact Mass | 208.05 |
| IUPAC Name | (3aR,4R,5S,6aR)-6,6-difluoro-2,5-dihydroxy-2,3,3a,4,5,6a-hexahydrocyclopenta[b]furan-4-carbaldehyde |
| SMILES | O=C[C@@H]1[C@H]2CC(O)O[C@H]2C(F)(F)[C@H]1O |
| InChI | InChI=1S/C8H10F2O4/c9-8(10)6(13)4(2-11)3-1-5(12)14-7(3)8/h2-7,12-13H,1H2/t3-,4-,5?,6+,7-/m1/s1 |
| InChIKey | ZXFWDUHMRXGOMA-VXDYUFBISA-N |
| XLogP | -0.47 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.16 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|