C20H21N3O3S — CID 1279674
N-cyclohexyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzenesulfonamide (PubChem CID 1279674) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is N-cyclohexyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzenesulfonamide.
| Compound Name | N-cyclohexyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 1279674 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | N-cyclohexyl-3-(5-phenyl-1,3,4-oxadiazol-2-yl)benzenesulfonamide |
| SMILES | O=S(=O)(NC1CCCCC1)c1cccc(-c2nnc(-c3ccccc3)o2)c1 |
| InChI | InChI=1S/C20H21N3O3S/c24-27(25,23-17-11-5-2-6-12-17)18-13-7-10-16(14-18)20-22-21-19(26-20)15-8-3-1-4-9-15/h1,3-4,7-10,13-14,17,23H,2,5-6,11-12H2 |
| InChIKey | YAWISMKQAPRZFW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |