C22H34N4O4 — CID 12797431
N-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(1,3,4-oxadiazol-2-yl)phenyl]heptanamide (PubChem CID 12797431) has the molecular formula C22H34N4O4 and a molecular weight of 418.54 g/mol. Its IUPAC name is N-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(1,3,4-oxadiazol-2-yl)phenyl]heptanamide.
| Compound Name | N-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(1,3,4-oxadiazol-2-yl)phenyl]heptanamide |
|---|---|
| PubChem CID | 12797431 |
| Molecular Formula | C22H34N4O4 |
| Molecular Weight | 418.54 g/mol |
| Exact Mass | 418.26 |
| IUPAC Name | N-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(1,3,4-oxadiazol-2-yl)phenyl]heptanamide |
| SMILES | CCCCCCC(=O)Nc1ccc(OCC(O)CNC(C)(C)C)c(-c2nnco2)c1 |
| InChI | InChI=1S/C22H34N4O4/c1-5-6-7-8-9-20(28)25-16-10-11-19(18(12-16)21-26-24-15-30-21)29-14-17(27)13-23-22(2,3)4/h10-12,15,17,23,27H,5-9,13-14H2,1-4H3,(H,25,28) |
| InChIKey | IGUWDVUPHUSKBP-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.54 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|