C25H40N4O4 — CID 12797435
N-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(1,3,4-oxadiazol-2-yl)phenyl]decanamide (PubChem CID 12797435) has the molecular formula C25H40N4O4 and a molecular weight of 460.62 g/mol. Its IUPAC name is N-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(1,3,4-oxadiazol-2-yl)phenyl]decanamide.
| Compound Name | N-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(1,3,4-oxadiazol-2-yl)phenyl]decanamide |
|---|---|
| PubChem CID | 12797435 |
| Molecular Formula | C25H40N4O4 |
| Molecular Weight | 460.62 g/mol |
| Exact Mass | 460.30 |
| IUPAC Name | N-[4-[3-(tert-butylamino)-2-hydroxypropoxy]-3-(1,3,4-oxadiazol-2-yl)phenyl]decanamide |
| SMILES | CCCCCCCCCC(=O)Nc1ccc(OCC(O)CNC(C)(C)C)c(-c2nnco2)c1 |
| InChI | InChI=1S/C25H40N4O4/c1-5-6-7-8-9-10-11-12-23(31)28-19-13-14-22(21(15-19)24-29-27-18-33-24)32-17-20(30)16-26-25(2,3)4/h13-15,18,20,26,30H,5-12,16-17H2,1-4H3,(H,28,31) |
| InChIKey | RHWKOKCZGPGFQW-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 109.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.62 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|