About 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine
3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine (PubChem CID 1279760) has the molecular formula C20H22ClN3S
and a molecular weight of 371.94 g/mol. Its IUPAC name is 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine |
| PubChem CID | 1279760 |
| Molecular Formula | C20H22ClN3S |
| Molecular Weight | 371.94 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCn1c(-c2ccc(Cl)cc2)cs/c1=N\c1ccccc1 |
| InChI | InChI=1S/C20H22ClN3S/c1-23(2)13-6-14-24-19(16-9-11-17(21)12-10-16)15-25-20(24)22-18-7-4-3-5-8-18/h3-5,7-12,15H,6,13-14H2,1-2H3/b22-20- |
| InChIKey | KUGBMOYLIHPSFR-XDOYNYLZSA-N |
| XLogP | 5.05 |
| TPSA | 20.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.94 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine (CID 1279760) is 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine is CN(C)CCCn1c(-c2ccc(Cl)cc2)cs/c1=N\c1ccccc1.
What is the InChIKey of 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine?
The InChIKey is KUGBMOYLIHPSFR-XDOYNYLZSA-N. The full InChI is InChI=1S/C20H22ClN3S/c1-23(2)13-6-14-24-19(16-9-11-17(21)12-10-16)15-25-20(24)22-18-7-4-3-5-8-18/h3-5,7-12,15H,6,13-14H2,1-2H3/b22-20-.
What are the key properties of 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine?
3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine has a molecular weight of 371.94 g/mol, XLogP of 5.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-(4-chlorophenyl)-2-phenylimino-1,3-thiazol-3-yl]-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 1279760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).