About 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile
1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile (PubChem CID 12797756) has the molecular formula C8H9N3O3
and a molecular weight of 195.18 g/mol. Its IUPAC name is 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile.
Molecular Properties
| Compound Name | 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile |
| PubChem CID | 12797756 |
| Molecular Formula | C8H9N3O3 |
| Molecular Weight | 195.18 g/mol |
| Exact Mass | 195.06 |
| IUPAC Name | 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile |
| SMILES | CCOCn1cc(C#N)c(=O)[nH]c1=O |
| InChI | InChI=1S/C8H9N3O3/c1-2-14-5-11-4-6(3-9)7(12)10-8(11)13/h4H,2,5H2,1H3,(H,10,12,13) |
| InChIKey | PYUCXESPQOSBFF-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 87.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.18 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile?
The IUPAC name of 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile (CID 12797756) is 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile.
What is the SMILES notation for 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile?
The canonical SMILES for 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile is CCOCn1cc(C#N)c(=O)[nH]c1=O.
What is the InChIKey of 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile?
The InChIKey is PYUCXESPQOSBFF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N3O3/c1-2-14-5-11-4-6(3-9)7(12)10-8(11)13/h4H,2,5H2,1H3,(H,10,12,13).
What are the key properties of 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile?
1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile has a molecular weight of 195.18 g/mol, XLogP of -0.60, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(ethoxymethyl)-2,4-dioxopyrimidine-5-carbonitrile is sourced from PubChem (CID 12797756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).