C11H15NO2 — CID 12798232
8-methoxy-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one (PubChem CID 12798232) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is 8-methoxy-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one.
| Compound Name | 8-methoxy-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one |
|---|---|
| PubChem CID | 12798232 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | 8-methoxy-2-methyl-5,6,7,8-tetrahydro-1H-quinolin-4-one |
| SMILES | COC1CCCc2c1[nH]c(C)cc2=O |
| InChI | InChI=1S/C11H15NO2/c1-7-6-9(13)8-4-3-5-10(14-2)11(8)12-7/h6,10H,3-5H2,1-2H3,(H,12,13) |
| InChIKey | LYOVQYKPFRJRKB-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 42.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |