N,N-di(propan-2-yl)sulfamoyl chloride

C6H14ClNO2S — CID 12798264

IUPACN,N-di(propan-2-yl)sulfamoyl chloride
SMILESCC(C)N(C(C)C)S(=O)(=O)Cl
InChIInChI=1S/C6H14ClNO2S/c1-5(2)8(6(3)4)11(7,9)10/h5-6H,1-4H3
InChIKeySFDYIYJEECZQQX-UHFFFAOYSA-N
MW199.70 g/mol
LogP1.59
Rot. Bonds3

About N,N-di(propan-2-yl)sulfamoyl chloride

N,N-di(propan-2-yl)sulfamoyl chloride (PubChem CID 12798264) has the molecular formula C6H14ClNO2S and a molecular weight of 199.70 g/mol. Its IUPAC name is N,N-di(propan-2-yl)sulfamoyl chloride.

Molecular Properties

Compound NameN,N-di(propan-2-yl)sulfamoyl chloride
PubChem CID12798264
Molecular FormulaC6H14ClNO2S
Molecular Weight199.70 g/mol
Exact Mass199.04
IUPAC NameN,N-di(propan-2-yl)sulfamoyl chloride
SMILESCC(C)N(C(C)C)S(=O)(=O)Cl
InChIInChI=1S/C6H14ClNO2S/c1-5(2)8(6(3)4)11(7,9)10/h5-6H,1-4H3
InChIKeySFDYIYJEECZQQX-UHFFFAOYSA-N
XLogP1.59
TPSA37.38 Ų
H-Bond Donors
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500199.70
LogP ≤ 51.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 102

Analyze N,N-di(propan-2-yl)sulfamoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of N,N-di(propan-2-yl)sulfamoyl chloride?
The IUPAC name of N,N-di(propan-2-yl)sulfamoyl chloride (CID 12798264) is N,N-di(propan-2-yl)sulfamoyl chloride.
What is the SMILES notation for N,N-di(propan-2-yl)sulfamoyl chloride?
The canonical SMILES for N,N-di(propan-2-yl)sulfamoyl chloride is CC(C)N(C(C)C)S(=O)(=O)Cl.
What is the InChIKey of N,N-di(propan-2-yl)sulfamoyl chloride?
The InChIKey is SFDYIYJEECZQQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14ClNO2S/c1-5(2)8(6(3)4)11(7,9)10/h5-6H,1-4H3.
What are the key properties of N,N-di(propan-2-yl)sulfamoyl chloride?
N,N-di(propan-2-yl)sulfamoyl chloride has a molecular weight of 199.70 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-di(propan-2-yl)sulfamoyl chloride is sourced from PubChem (CID 12798264), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).