About O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate
O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate (PubChem CID 1279828) has the molecular formula C12H14N2OS2
and a molecular weight of 266.39 g/mol. Its IUPAC name is O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate.
Molecular Properties
| Compound Name | O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate |
| PubChem CID | 1279828 |
| Molecular Formula | C12H14N2OS2 |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate |
| SMILES | CCOC(=S)SCc1cn2cccc(C)c2n1 |
| InChI | InChI=1S/C12H14N2OS2/c1-3-15-12(16)17-8-10-7-14-6-4-5-9(2)11(14)13-10/h4-7H,3,8H2,1-2H3 |
| InChIKey | WMYVPKJGICOILU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 26.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate?
The IUPAC name of O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate (CID 1279828) is O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate.
What is the SMILES notation for O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate?
The canonical SMILES for O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate is CCOC(=S)SCc1cn2cccc(C)c2n1.
What is the InChIKey of O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate?
The InChIKey is WMYVPKJGICOILU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2OS2/c1-3-15-12(16)17-8-10-7-14-6-4-5-9(2)11(14)13-10/h4-7H,3,8H2,1-2H3.
What are the key properties of O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate?
O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate has a molecular weight of 266.39 g/mol, XLogP of 3.20, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for O-ethyl (8-methylimidazo[1,2-a]pyridin-2-yl)methylsulfanylmethanethioate is sourced from PubChem (CID 1279828), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).