C28H35NO3 — CID 12799135
(2E,4E,6E,8E)-N-(1,3-benzodioxol-5-ylmethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide (PubChem CID 12799135) has the molecular formula C28H35NO3 and a molecular weight of 433.59 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-(1,3-benzodioxol-5-ylmethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide.
| Compound Name | (2E,4E,6E,8E)-N-(1,3-benzodioxol-5-ylmethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
|---|---|
| PubChem CID | 12799135 |
| Molecular Formula | C28H35NO3 |
| Molecular Weight | 433.59 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | (2E,4E,6E,8E)-N-(1,3-benzodioxol-5-ylmethyl)-3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraenamide |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)NCc2ccc3c(c2)OCO3)C(C)(C)CCC1 |
| InChI | InChI=1S/C28H35NO3/c1-20(11-13-24-22(3)10-7-15-28(24,4)5)8-6-9-21(2)16-27(30)29-18-23-12-14-25-26(17-23)32-19-31-25/h6,8-9,11-14,16-17H,7,10,15,18-19H2,1-5H3,(H,29,30)/b9-6+,13-11+,20-8+,21-16+ |
| InChIKey | GGLSCUJQJQVLIK-TTXBIKQHSA-N |
| XLogP | 6.56 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.59 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|