C16H24N4O3 — CID 127992628
N-[1-(3-methoxy-4-pyridinyl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxamide (PubChem CID 127992628) has the molecular formula C16H24N4O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is N-[1-(3-methoxy-4-pyridinyl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxamide.
| Compound Name | N-[1-(3-methoxy-4-pyridinyl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxamide |
|---|---|
| PubChem CID | 127992628 |
| Molecular Formula | C16H24N4O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.18 |
| IUPAC Name | N-[1-(3-methoxy-4-pyridinyl)ethyl]-3,4,6,7,9,9a-hexahydro-1H-pyrazino[2,1-c][1,4]oxazine-8-carboxamide |
| SMILES | COc1cnccc1C(C)NC(=O)N1CCN2CCOCC2C1 |
| InChI | InChI=1S/C16H24N4O3/c1-12(14-3-4-17-9-15(14)22-2)18-16(21)20-6-5-19-7-8-23-11-13(19)10-20/h3-4,9,12-13H,5-8,10-11H2,1-2H3,(H,18,21) |
| InChIKey | GLWVZLBEHBUNJU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 66.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |