About 1,3-dimethyladamantane
1,3-dimethyladamantane (PubChem CID 12800) has the molecular formula C12H20
and a molecular weight of 164.29 g/mol. Its IUPAC name is 1,3-dimethyladamantane.
Molecular Properties
| Compound Name | 1,3-dimethyladamantane |
| PubChem CID | 12800 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | 1,3-dimethyladamantane |
| SMILES | CC12CC3CC(C1)CC(C)(C3)C2 |
| InChI | InChI=1S/C12H20/c1-11-4-9-3-10(5-11)7-12(2,6-9)8-11/h9-10H,3-8H2,1-2H3 |
| InChIKey | CWNOIUTVJRWADX-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1,3-dimethyladamantane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyladamantane?
The IUPAC name of 1,3-dimethyladamantane (CID 12800) is 1,3-dimethyladamantane.
What is the SMILES notation for 1,3-dimethyladamantane?
The canonical SMILES for 1,3-dimethyladamantane is CC12CC3CC(C1)CC(C)(C3)C2.
What is the InChIKey of 1,3-dimethyladamantane?
The InChIKey is CWNOIUTVJRWADX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20/c1-11-4-9-3-10(5-11)7-12(2,6-9)8-11/h9-10H,3-8H2,1-2H3.
What are the key properties of 1,3-dimethyladamantane?
1,3-dimethyladamantane has a molecular weight of 164.29 g/mol, XLogP of 3.61, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyladamantane is sourced from PubChem (CID 12800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).