C28H29F3N2O4 — CID 12800787
diethyl 2,6-dimethyl-1-(N-methyl-C-phenylcarbonimidoyl)-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate (PubChem CID 12800787) has the molecular formula C28H29F3N2O4 and a molecular weight of 514.54 g/mol. Its IUPAC name is diethyl 2,6-dimethyl-1-(N-methyl-C-phenylcarbonimidoyl)-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate.
| Compound Name | diethyl 2,6-dimethyl-1-(N-methyl-C-phenylcarbonimidoyl)-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 12800787 |
| Molecular Formula | C28H29F3N2O4 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.21 |
| IUPAC Name | diethyl 2,6-dimethyl-1-(N-methyl-C-phenylcarbonimidoyl)-4-[2-(trifluoromethyl)phenyl]-4H-pyridine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)N(/C(=N/C)c2ccccc2)C(C)=C(C(=O)OCC)C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C28H29F3N2O4/c1-6-36-26(34)22-17(3)33(25(32-5)19-13-9-8-10-14-19)18(4)23(27(35)37-7-2)24(22)20-15-11-12-16-21(20)28(29,30)31/h8-16,24H,6-7H2,1-5H3/b32-25+ |
| InChIKey | MKJNUZVBPXVZHM-WGPBWIAQSA-N |
| XLogP | 5.86 |
| TPSA | 68.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|