About (4-nitrophenyl)methyl 2-aminoacetate
(4-nitrophenyl)methyl 2-aminoacetate (PubChem CID 12800846) has the molecular formula C9H10N2O4
and a molecular weight of 210.19 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 2-aminoacetate.
Molecular Properties
| Compound Name | (4-nitrophenyl)methyl 2-aminoacetate |
| PubChem CID | 12800846 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | (4-nitrophenyl)methyl 2-aminoacetate |
| SMILES | NCC(=O)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C9H10N2O4/c10-5-9(12)15-6-7-1-3-8(4-2-7)11(13)14/h1-4H,5-6,10H2 |
| InChIKey | IWSWFVNUXDVDLT-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitrophenyl)methyl 2-aminoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitrophenyl)methyl 2-aminoacetate?
The IUPAC name of (4-nitrophenyl)methyl 2-aminoacetate (CID 12800846) is (4-nitrophenyl)methyl 2-aminoacetate.
What is the SMILES notation for (4-nitrophenyl)methyl 2-aminoacetate?
The canonical SMILES for (4-nitrophenyl)methyl 2-aminoacetate is NCC(=O)OCc1ccc([N+](=O)[O-])cc1.
What is the InChIKey of (4-nitrophenyl)methyl 2-aminoacetate?
The InChIKey is IWSWFVNUXDVDLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4/c10-5-9(12)15-6-7-1-3-8(4-2-7)11(13)14/h1-4H,5-6,10H2.
What are the key properties of (4-nitrophenyl)methyl 2-aminoacetate?
(4-nitrophenyl)methyl 2-aminoacetate has a molecular weight of 210.19 g/mol, XLogP of 0.60, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitrophenyl)methyl 2-aminoacetate is sourced from PubChem (CID 12800846), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).