About 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide
1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide (PubChem CID 12801592) has the molecular formula C19H22BrFN2
and a molecular weight of 377.30 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide.
Molecular Properties
| Compound Name | 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide |
| PubChem CID | 12801592 |
| Molecular Formula | C19H22BrFN2 |
| Molecular Weight | 377.30 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide |
| SMILES | Br.CN1CCC2(CC1)CN(c1ccc(F)cc1)c1ccccc12 |
| InChI | InChI=1S/C19H21FN2.BrH/c1-21-12-10-19(11-13-21)14-22(16-8-6-15(20)7-9-16)18-5-3-2-4-17(18)19;/h2-9H,10-14H2,1H3;1H |
| InChIKey | DYHJHSQDZQGLCS-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 377.30 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide?
The IUPAC name of 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide (CID 12801592) is 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide.
What is the SMILES notation for 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide?
The canonical SMILES for 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide is Br.CN1CCC2(CC1)CN(c1ccc(F)cc1)c1ccccc12.
What is the InChIKey of 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide?
The InChIKey is DYHJHSQDZQGLCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21FN2.BrH/c1-21-12-10-19(11-13-21)14-22(16-8-6-15(20)7-9-16)18-5-3-2-4-17(18)19;/h2-9H,10-14H2,1H3;1H.
What are the key properties of 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide?
1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide has a molecular weight of 377.30 g/mol, XLogP of 4.52, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-fluorophenyl)-1'-methylspiro[2H-indole-3,4'-piperidine];hydrobromide is sourced from PubChem (CID 12801592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).