About N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride
N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride (PubChem CID 12801610) has the molecular formula C20H26ClN3
and a molecular weight of 343.90 g/mol. Its IUPAC name is N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride |
| PubChem CID | 12801610 |
| Molecular Formula | C20H26ClN3 |
| Molecular Weight | 343.90 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride |
| SMILES | CNc1ccccc1N1CC2(CCN(C)CC2)c2ccccc21.Cl |
| InChI | InChI=1S/C20H25N3.ClH/c1-21-17-8-4-6-10-19(17)23-15-20(11-13-22(2)14-12-20)16-7-3-5-9-18(16)23;/h3-10,21H,11-15H2,1-2H3;1H |
| InChIKey | XRJFRUDKDJEOLC-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.90 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride?
The IUPAC name of N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride (CID 12801610) is N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride.
What is the SMILES notation for N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride?
The canonical SMILES for N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride is CNc1ccccc1N1CC2(CCN(C)CC2)c2ccccc21.Cl.
What is the InChIKey of N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride?
The InChIKey is XRJFRUDKDJEOLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N3.ClH/c1-21-17-8-4-6-10-19(17)23-15-20(11-13-22(2)14-12-20)16-7-3-5-9-18(16)23;/h3-10,21H,11-15H2,1-2H3;1H.
What are the key properties of N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride?
N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride has a molecular weight of 343.90 g/mol, XLogP of 4.27, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-2-(1'-methylspiro[2H-indole-3,4'-piperidine]-1-yl)aniline;hydrochloride is sourced from PubChem (CID 12801610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).