About 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine
8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine (PubChem CID 12802019) has the molecular formula C20H18ClN3O
and a molecular weight of 351.84 g/mol. Its IUPAC name is 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine.
Molecular Properties
| Compound Name | 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine |
| PubChem CID | 12802019 |
| Molecular Formula | C20H18ClN3O |
| Molecular Weight | 351.84 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine |
| SMILES | COCc1nc(C)n2c1CN=C(c1ccccc1)c1cc(Cl)ccc1-2 |
| InChI | InChI=1S/C20H18ClN3O/c1-13-23-17(12-25-2)19-11-22-20(14-6-4-3-5-7-14)16-10-15(21)8-9-18(16)24(13)19/h3-10H,11-12H2,1-2H3 |
| InChIKey | AFECOKGZKFILSQ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 39.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.84 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine?
The IUPAC name of 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine (CID 12802019) is 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine.
What is the SMILES notation for 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine?
The canonical SMILES for 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine is COCc1nc(C)n2c1CN=C(c1ccccc1)c1cc(Cl)ccc1-2.
What is the InChIKey of 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine?
The InChIKey is AFECOKGZKFILSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClN3O/c1-13-23-17(12-25-2)19-11-22-20(14-6-4-3-5-7-14)16-10-15(21)8-9-18(16)24(13)19/h3-10H,11-12H2,1-2H3.
What are the key properties of 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine?
8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine has a molecular weight of 351.84 g/mol, XLogP of 4.33, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-chloro-3-(methoxymethyl)-1-methyl-6-phenyl-4H-imidazo[1,5-a][1,4]benzodiazepine is sourced from PubChem (CID 12802019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).