C8H17BrN6S — CID 12802960
1-[2-(4-methylpiperazin-1-yl)ethyl]-2H-tetrazole-5-thione;hydrobromide (PubChem CID 12802960) has the molecular formula C8H17BrN6S and a molecular weight of 309.24 g/mol. Its IUPAC name is 1-[2-(4-methylpiperazin-1-yl)ethyl]-2H-tetrazole-5-thione;hydrobromide.
| Compound Name | 1-[2-(4-methylpiperazin-1-yl)ethyl]-2H-tetrazole-5-thione;hydrobromide |
|---|---|
| PubChem CID | 12802960 |
| Molecular Formula | C8H17BrN6S |
| Molecular Weight | 309.24 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-[2-(4-methylpiperazin-1-yl)ethyl]-2H-tetrazole-5-thione;hydrobromide |
| SMILES | Br.CN1CCN(CCn2[nH]nnc2=S)CC1 |
| InChI | InChI=1S/C8H16N6S.BrH/c1-12-2-4-13(5-3-12)6-7-14-8(15)9-10-11-14;/h2-7H2,1H3,(H,9,11,15);1H |
| InChIKey | GWQGORZSAISNGC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 52.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.24 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|