About 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine
5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine (PubChem CID 12803497) has the molecular formula C11H5BrF3N5O4
and a molecular weight of 408.09 g/mol. Its IUPAC name is 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| PubChem CID | 12803497 |
| Molecular Formula | C11H5BrF3N5O4 |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 406.95 |
| IUPAC Name | 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ncc(Br)cn2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H5BrF3N5O4/c12-5-3-16-10(17-4-5)18-9-7(11(13,14)15)1-6(19(21)22)2-8(9)20(23)24/h1-4H,(H,16,17,18) |
| InChIKey | BHWNWXPASZHHQC-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 124.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine?
The IUPAC name of 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine (CID 12803497) is 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine.
What is the SMILES notation for 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine?
The canonical SMILES for 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine is O=[N+]([O-])c1cc([N+](=O)[O-])c(Nc2ncc(Br)cn2)c(C(F)(F)F)c1.
What is the InChIKey of 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine?
The InChIKey is BHWNWXPASZHHQC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H5BrF3N5O4/c12-5-3-16-10(17-4-5)18-9-7(11(13,14)15)1-6(19(21)22)2-8(9)20(23)24/h1-4H,(H,16,17,18).
What are the key properties of 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine?
5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine has a molecular weight of 408.09 g/mol, XLogP of 3.82, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-N-[2,4-dinitro-6-(trifluoromethyl)phenyl]pyrimidin-2-amine is sourced from PubChem (CID 12803497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).