About 7-hydroxy-4H-1,4-benzoxazine-2,3-dione
7-hydroxy-4H-1,4-benzoxazine-2,3-dione (PubChem CID 12803687) has the molecular formula C8H5NO4
and a molecular weight of 179.13 g/mol. Its IUPAC name is 7-hydroxy-4H-1,4-benzoxazine-2,3-dione.
Molecular Properties
| Compound Name | 7-hydroxy-4H-1,4-benzoxazine-2,3-dione |
| PubChem CID | 12803687 |
| Molecular Formula | C8H5NO4 |
| Molecular Weight | 179.13 g/mol |
| Exact Mass | 179.02 |
| IUPAC Name | 7-hydroxy-4H-1,4-benzoxazine-2,3-dione |
| SMILES | O=c1[nH]c2ccc(O)cc2oc1=O |
| InChI | InChI=1S/C8H5NO4/c10-4-1-2-5-6(3-4)13-8(12)7(11)9-5/h1-3,10H,(H,9,11) |
| InChIKey | LXWXFKYFMODNMK-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 83.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.13 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 7-hydroxy-4H-1,4-benzoxazine-2,3-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-4H-1,4-benzoxazine-2,3-dione?
The IUPAC name of 7-hydroxy-4H-1,4-benzoxazine-2,3-dione (CID 12803687) is 7-hydroxy-4H-1,4-benzoxazine-2,3-dione.
What is the SMILES notation for 7-hydroxy-4H-1,4-benzoxazine-2,3-dione?
The canonical SMILES for 7-hydroxy-4H-1,4-benzoxazine-2,3-dione is O=c1[nH]c2ccc(O)cc2oc1=O.
What is the InChIKey of 7-hydroxy-4H-1,4-benzoxazine-2,3-dione?
The InChIKey is LXWXFKYFMODNMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5NO4/c10-4-1-2-5-6(3-4)13-8(12)7(11)9-5/h1-3,10H,(H,9,11).
What are the key properties of 7-hydroxy-4H-1,4-benzoxazine-2,3-dione?
7-hydroxy-4H-1,4-benzoxazine-2,3-dione has a molecular weight of 179.13 g/mol, XLogP of 0.19, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-4H-1,4-benzoxazine-2,3-dione is sourced from PubChem (CID 12803687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).