C26H26N4O — CID 1280376
5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-phenyl-1,2,4-oxadiazole (PubChem CID 1280376) has the molecular formula C26H26N4O and a molecular weight of 410.52 g/mol. Its IUPAC name is 5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-phenyl-1,2,4-oxadiazole.
| Compound Name | 5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-phenyl-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 1280376 |
| Molecular Formula | C26H26N4O |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 5-[(4-benzhydrylpiperazin-1-yl)methyl]-3-phenyl-1,2,4-oxadiazole |
| SMILES | c1ccc(-c2noc(CN3CCN(C(c4ccccc4)c4ccccc4)CC3)n2)cc1 |
| InChI | InChI=1S/C26H26N4O/c1-4-10-21(11-5-1)25(22-12-6-2-7-13-22)30-18-16-29(17-19-30)20-24-27-26(28-31-24)23-14-8-3-9-15-23/h1-15,25H,16-20H2 |
| InChIKey | SKWVFSCLLXIEEJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 45.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |