About cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate
cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate (PubChem CID 12805020) has the molecular formula C16H19N3O3
and a molecular weight of 301.35 g/mol. Its IUPAC name is cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate.
Molecular Properties
| Compound Name | cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate |
| PubChem CID | 12805020 |
| Molecular Formula | C16H19N3O3 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.14 |
| IUPAC Name | cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate |
| SMILES | CC1CC(=O)NN=C1c1ccc(NC(=O)OCC2CC2)cc1 |
| InChI | InChI=1S/C16H19N3O3/c1-10-8-14(20)18-19-15(10)12-4-6-13(7-5-12)17-16(21)22-9-11-2-3-11/h4-7,10-11H,2-3,8-9H2,1H3,(H,17,21)(H,18,20) |
| InChIKey | AOQRXVFAPUGHCP-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate?
The IUPAC name of cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate (CID 12805020) is cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate.
What is the SMILES notation for cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate?
The canonical SMILES for cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate is CC1CC(=O)NN=C1c1ccc(NC(=O)OCC2CC2)cc1.
What is the InChIKey of cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate?
The InChIKey is AOQRXVFAPUGHCP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O3/c1-10-8-14(20)18-19-15(10)12-4-6-13(7-5-12)17-16(21)22-9-11-2-3-11/h4-7,10-11H,2-3,8-9H2,1H3,(H,17,21)(H,18,20).
What are the key properties of cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate?
cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate has a molecular weight of 301.35 g/mol, XLogP of 2.51, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylmethyl N-[4-(4-methyl-6-oxo-4,5-dihydro-1H-pyridazin-3-yl)phenyl]carbamate is sourced from PubChem (CID 12805020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).