C28H35NO2 — CID 12805058
2-(3-benzoylphenyl)-1-[2-(cyclohexylmethyl)piperidin-1-yl]propan-1-one (PubChem CID 12805058) has the molecular formula C28H35NO2 and a molecular weight of 417.59 g/mol. Its IUPAC name is 2-(3-benzoylphenyl)-1-[2-(cyclohexylmethyl)piperidin-1-yl]propan-1-one.
| Compound Name | 2-(3-benzoylphenyl)-1-[2-(cyclohexylmethyl)piperidin-1-yl]propan-1-one |
|---|---|
| PubChem CID | 12805058 |
| Molecular Formula | C28H35NO2 |
| Molecular Weight | 417.59 g/mol |
| Exact Mass | 417.27 |
| IUPAC Name | 2-(3-benzoylphenyl)-1-[2-(cyclohexylmethyl)piperidin-1-yl]propan-1-one |
| SMILES | CC(C(=O)N1CCCCC1CC1CCCCC1)c1cccc(C(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C28H35NO2/c1-21(24-15-10-16-25(20-24)27(30)23-13-6-3-7-14-23)28(31)29-18-9-8-17-26(29)19-22-11-4-2-5-12-22/h3,6-7,10,13-16,20-22,26H,2,4-5,8-9,11-12,17-19H2,1H3 |
| InChIKey | CXHHGFWXVDGQON-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.59 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |